htmnz585 htmnz585

02-10-2017
Mathematics

contestada

what is a comparison sentence to represent this equation 6 x 7 = 42

Respuesta :

Аноним Аноним

02-10-2017

6 times as many as 7 is 42 is your comparison sentence

Answer Link

Otras preguntas

Which geological era is known as the age of reptiles?

By adding white to a color to make it lighter, a new ____ of the original color can be created

PLEASE HELP! ( will give brainliest)

ABCD is a trapezoid. AB= 2.5cm, and CD= 4cm, and the area= 6.5cm squared. What is the altitude of the trapezoid?

what do phases mean!?Plz Help Me This Is A Proyect

How many milligrams of drug are in 45 mL of a 1.5% w/v solution?

The governor of a state earns $54,625 more than the governor of state B. If the total of their salaries is 286,165, find the salaries of each

"which heavy metal group was the first to reach megastar success?"

20 POINTS! NEED YOUR OPINION! Social networks have overthrown governments in some Arab countries. Could the same thing happen to your government? Give specific

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)